(4-benzyl-3,4-dihydro-2H-1,4-benzothiazin-6-yl)(4-phenylpiperazin-1-yl)methanone
Chemical Structure Depiction of
(4-benzyl-3,4-dihydro-2H-1,4-benzothiazin-6-yl)(4-phenylpiperazin-1-yl)methanone
(4-benzyl-3,4-dihydro-2H-1,4-benzothiazin-6-yl)(4-phenylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | C699-0232 |
| Compound Name: | (4-benzyl-3,4-dihydro-2H-1,4-benzothiazin-6-yl)(4-phenylpiperazin-1-yl)methanone |
| Molecular Weight: | 429.58 |
| Molecular Formula: | C26 H27 N3 O S |
| Smiles: | C1CN(CCN1C(c1ccc2c(c1)N(CCS2)Cc1ccccc1)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.3595 |
| logD: | 4.3595 |
| logSw: | -4.3797 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 22.7098 |
| InChI Key: | XRXRNMPLQFOYGE-UHFFFAOYSA-N |