N-(4-ethoxyphenyl)-4-[(4-methylphenyl)methyl]-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-4-[(4-methylphenyl)methyl]-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide
N-(4-ethoxyphenyl)-4-[(4-methylphenyl)methyl]-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide
Compound characteristics
| Compound ID: | C699-0338 |
| Compound Name: | N-(4-ethoxyphenyl)-4-[(4-methylphenyl)methyl]-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide |
| Molecular Weight: | 418.56 |
| Molecular Formula: | C25 H26 N2 O2 S |
| Smiles: | CCOc1ccc(cc1)NC(c1ccc2c(c1)N(CCS2)Cc1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5196 |
| logD: | 5.5196 |
| logSw: | -5.2951 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.016 |
| InChI Key: | KXFAECXUDSONMK-UHFFFAOYSA-N |