1-acetyl-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dihydro-1H-indole-2-carboxamide
Chemical Structure Depiction of
1-acetyl-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dihydro-1H-indole-2-carboxamide
1-acetyl-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dihydro-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | C700-1722 |
| Compound Name: | 1-acetyl-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dihydro-1H-indole-2-carboxamide |
| Molecular Weight: | 379.5 |
| Molecular Formula: | C23 H29 N3 O2 |
| Smiles: | CCN(CCCNC(C1Cc2ccccc2N1C(C)=O)=O)c1cccc(C)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4359 |
| logD: | 3.4036 |
| logSw: | -3.6753 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.249 |
| InChI Key: | FICDFVLPQGLJRP-QFIPXVFZSA-N |