1-(3,4-dimethoxybenzene-1-sulfonyl)-5'-ethyl-7'-methyl-5'H-spiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline]
Chemical Structure Depiction of
1-(3,4-dimethoxybenzene-1-sulfonyl)-5'-ethyl-7'-methyl-5'H-spiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline]
1-(3,4-dimethoxybenzene-1-sulfonyl)-5'-ethyl-7'-methyl-5'H-spiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline]
Compound characteristics
| Compound ID: | C700-2058 |
| Compound Name: | 1-(3,4-dimethoxybenzene-1-sulfonyl)-5'-ethyl-7'-methyl-5'H-spiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline] |
| Molecular Weight: | 481.61 |
| Molecular Formula: | C26 H31 N3 O4 S |
| Smiles: | CCN1c2cc(C)ccc2n2cccc2C12CCN(CC2)S(c1ccc(c(c1)OC)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0436 |
| logD: | 5.0426 |
| logSw: | -4.6951 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 50.246 |
| InChI Key: | WIERDVUQKWHKBU-UHFFFAOYSA-N |