N~2~-(dimethylsulfamoyl)-N~2~-(4-methylphenyl)-N-[(2-methylphenyl)methyl]glycinamide
Chemical Structure Depiction of
N~2~-(dimethylsulfamoyl)-N~2~-(4-methylphenyl)-N-[(2-methylphenyl)methyl]glycinamide
N~2~-(dimethylsulfamoyl)-N~2~-(4-methylphenyl)-N-[(2-methylphenyl)methyl]glycinamide
Compound characteristics
| Compound ID: | C700-2170 |
| Compound Name: | N~2~-(dimethylsulfamoyl)-N~2~-(4-methylphenyl)-N-[(2-methylphenyl)methyl]glycinamide |
| Molecular Weight: | 375.49 |
| Molecular Formula: | C19 H25 N3 O3 S |
| Smiles: | Cc1ccc(cc1)N(CC(NCc1ccccc1C)=O)S(N(C)C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2503 |
| logD: | 3.2503 |
| logSw: | -3.3492 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.622 |
| InChI Key: | HQICWTFMLFCVBM-UHFFFAOYSA-N |