[4-(2,3-dimethylphenyl)piperazin-1-yl](4-ethyl-4H-thieno[3,2-b]pyrrol-5-yl)methanone
Chemical Structure Depiction of
[4-(2,3-dimethylphenyl)piperazin-1-yl](4-ethyl-4H-thieno[3,2-b]pyrrol-5-yl)methanone
[4-(2,3-dimethylphenyl)piperazin-1-yl](4-ethyl-4H-thieno[3,2-b]pyrrol-5-yl)methanone
Compound characteristics
| Compound ID: | C703-1151 |
| Compound Name: | [4-(2,3-dimethylphenyl)piperazin-1-yl](4-ethyl-4H-thieno[3,2-b]pyrrol-5-yl)methanone |
| Molecular Weight: | 367.51 |
| Molecular Formula: | C21 H25 N3 O S |
| Smiles: | CCn1c(cc2c1ccs2)C(N1CCN(CC1)c1cccc(C)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8069 |
| logD: | 4.8069 |
| logSw: | -4.6088 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 21.3148 |
| InChI Key: | LEZQAMWESMVTIK-UHFFFAOYSA-N |