2-[6-(diethylsulfamoyl)-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl]-N-(2,5-dimethylphenyl)acetamide
Chemical Structure Depiction of
2-[6-(diethylsulfamoyl)-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl]-N-(2,5-dimethylphenyl)acetamide
2-[6-(diethylsulfamoyl)-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl]-N-(2,5-dimethylphenyl)acetamide
Compound characteristics
| Compound ID: | C706-0052 |
| Compound Name: | 2-[6-(diethylsulfamoyl)-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl]-N-(2,5-dimethylphenyl)acetamide |
| Molecular Weight: | 461.6 |
| Molecular Formula: | C22 H27 N3 O4 S2 |
| Smiles: | CCN(CC)S(c1ccc2c(c1)N(CC(Nc1cc(C)ccc1C)=O)C(CS2)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0662 |
| logD: | 3.0662 |
| logSw: | -3.303 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.167 |
| InChI Key: | WOBDNXSUHGADKZ-UHFFFAOYSA-N |