2-(5-chloro-3-phenyl-1H-indazol-1-yl)-N-(2,3-dimethylphenyl)acetamide
Chemical Structure Depiction of
2-(5-chloro-3-phenyl-1H-indazol-1-yl)-N-(2,3-dimethylphenyl)acetamide
2-(5-chloro-3-phenyl-1H-indazol-1-yl)-N-(2,3-dimethylphenyl)acetamide
Compound characteristics
| Compound ID: | C707-0049 |
| Compound Name: | 2-(5-chloro-3-phenyl-1H-indazol-1-yl)-N-(2,3-dimethylphenyl)acetamide |
| Molecular Weight: | 389.88 |
| Molecular Formula: | C23 H20 Cl N3 O |
| Smiles: | Cc1cccc(c1C)NC(Cn1c2ccc(cc2c(c2ccccc2)n1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.5665 |
| logD: | 5.5665 |
| logSw: | -5.925 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.397 |
| InChI Key: | CPPGSTIYCFSQMK-UHFFFAOYSA-N |