2-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]-1-hydroxy-1,4-dihydro-1,2,4-benzotriazin-3(2H)-one
Chemical Structure Depiction of
2-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]-1-hydroxy-1,4-dihydro-1,2,4-benzotriazin-3(2H)-one
2-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]-1-hydroxy-1,4-dihydro-1,2,4-benzotriazin-3(2H)-one
Compound characteristics
| Compound ID: | C710-0115 |
| Compound Name: | 2-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]-1-hydroxy-1,4-dihydro-1,2,4-benzotriazin-3(2H)-one |
| Molecular Weight: | 367.36 |
| Molecular Formula: | C18 H17 N5 O4 |
| Smiles: | COc1ccc(cc1OC)c1cc([nH]n1)N1C(Nc2ccccc2N1O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3843 |
| logD: | 2.3293 |
| logSw: | -3.094 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 85.829 |
| InChI Key: | DCWKZAZRGBMPLM-UHFFFAOYSA-N |