{3-[(2-chlorophenyl)methyl]-1,3-diazinan-1-yl}(9-methyl-4H-thieno[3,2-c][1]benzopyran-2-yl)methanone
Chemical Structure Depiction of
{3-[(2-chlorophenyl)methyl]-1,3-diazinan-1-yl}(9-methyl-4H-thieno[3,2-c][1]benzopyran-2-yl)methanone
{3-[(2-chlorophenyl)methyl]-1,3-diazinan-1-yl}(9-methyl-4H-thieno[3,2-c][1]benzopyran-2-yl)methanone
Compound characteristics
| Compound ID: | C712-0313 |
| Compound Name: | {3-[(2-chlorophenyl)methyl]-1,3-diazinan-1-yl}(9-methyl-4H-thieno[3,2-c][1]benzopyran-2-yl)methanone |
| Molecular Weight: | 438.98 |
| Molecular Formula: | C24 H23 Cl N2 O2 S |
| Smiles: | Cc1cccc2c1c1c(CO2)cc(C(N2CCCN(Cc3ccccc3[Cl])C2)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 5.4299 |
| logD: | 5.4254 |
| logSw: | -6.0471 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.2838 |
| InChI Key: | QYLNZUWSGCZWKH-UHFFFAOYSA-N |