N-[(furan-2-yl)methyl]-N-methyl-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-N-methyl-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
N-[(furan-2-yl)methyl]-N-methyl-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | C712-1341 |
| Compound Name: | N-[(furan-2-yl)methyl]-N-methyl-4H-thieno[3,2-c][1]benzopyran-2-carboxamide |
| Molecular Weight: | 325.38 |
| Molecular Formula: | C18 H15 N O3 S |
| Smiles: | CN(Cc1ccco1)C(c1cc2COc3ccccc3c2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.574 |
| logD: | 3.574 |
| logSw: | -3.7625 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.254 |
| InChI Key: | QOCYPFZMUNMKFR-UHFFFAOYSA-N |