N-[2-(2,4-dimethoxyphenyl)ethyl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Chemical Structure Depiction of
N-[2-(2,4-dimethoxyphenyl)ethyl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
N-[2-(2,4-dimethoxyphenyl)ethyl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | C712-1357 |
| Compound Name: | N-[2-(2,4-dimethoxyphenyl)ethyl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide |
| Molecular Weight: | 395.48 |
| Molecular Formula: | C22 H21 N O4 S |
| Smiles: | COc1ccc(CCNC(c2cc3COc4ccccc4c3s2)=O)c(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 4.1754 |
| logD: | 4.1754 |
| logSw: | -4.3891 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.784 |
| InChI Key: | BRXRVSXTGLIPAN-UHFFFAOYSA-N |