N-[4-(furan-2-yl)butan-2-yl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Chemical Structure Depiction of
N-[4-(furan-2-yl)butan-2-yl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
N-[4-(furan-2-yl)butan-2-yl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | C712-1374 |
| Compound Name: | N-[4-(furan-2-yl)butan-2-yl]-4H-thieno[3,2-c][1]benzopyran-2-carboxamide |
| Molecular Weight: | 353.44 |
| Molecular Formula: | C20 H19 N O3 S |
| Smiles: | CC(CCc1ccco1)NC(c1cc2COc3ccccc3c2s1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3528 |
| logD: | 4.3528 |
| logSw: | -4.3569 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.959 |
| InChI Key: | FCWCRMSUUGOQTL-ZDUSSCGKSA-N |