4-oxo-N-(2-phenylethyl)-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
					Chemical Structure Depiction of
4-oxo-N-(2-phenylethyl)-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
			4-oxo-N-(2-phenylethyl)-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
Compound characteristics
| Compound ID: | C720-0015 | 
| Compound Name: | 4-oxo-N-(2-phenylethyl)-4H-pyrido[1,2-a]pyrimidine-3-carboxamide | 
| Molecular Weight: | 293.32 | 
| Molecular Formula: | C17 H15 N3 O2 | 
| Smiles: | C(CNC(C1=CN=C2C=CC=CN2C1=O)=O)c1ccccc1 | 
| Stereo: | ACHIRAL | 
| logP: | 1.0317 | 
| logD: | 1.0136 | 
| logSw: | -1.6087 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 49.728 | 
| InChI Key: | QNTFTJIXZAWMPO-UHFFFAOYSA-N | 
 
				 
				