7-methyl-N-[2-(methylsulfanyl)phenyl]-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
Chemical Structure Depiction of
7-methyl-N-[2-(methylsulfanyl)phenyl]-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
7-methyl-N-[2-(methylsulfanyl)phenyl]-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
Compound characteristics
| Compound ID: | C720-0503 |
| Compound Name: | 7-methyl-N-[2-(methylsulfanyl)phenyl]-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide |
| Molecular Weight: | 325.39 |
| Molecular Formula: | C17 H15 N3 O2 S |
| Smiles: | CC1C=CC2=NC=C(C(Nc3ccccc3SC)=O)C(N2C=1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0869 |
| logD: | 1.2483 |
| logSw: | -2.7422 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.386 |
| InChI Key: | JIVRDHORTXZHLL-UHFFFAOYSA-N |