2-hydroxy-N-[2-(4-methoxyphenyl)ethyl]-8-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
Chemical Structure Depiction of
2-hydroxy-N-[2-(4-methoxyphenyl)ethyl]-8-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
2-hydroxy-N-[2-(4-methoxyphenyl)ethyl]-8-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
Compound characteristics
| Compound ID: | C720-0608 |
| Compound Name: | 2-hydroxy-N-[2-(4-methoxyphenyl)ethyl]-8-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide |
| Molecular Weight: | 353.38 |
| Molecular Formula: | C19 H19 N3 O4 |
| Smiles: | [H]C1=CC(C)=C([H])C2=NC(=C(C(NCCc3ccc(cc3)OC)=O)C(N12)=O)O |
| Stereo: | ACHIRAL |
| logP: | 0.9675 |
| logD: | -4.9573 |
| logSw: | -1.8471 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.454 |
| InChI Key: | COEUBPXCYUHLNE-UHFFFAOYSA-N |