ethyl 1-[2-(2-fluoroanilino)-2-oxoethyl]-2-methyl-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 1-[2-(2-fluoroanilino)-2-oxoethyl]-2-methyl-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate
ethyl 1-[2-(2-fluoroanilino)-2-oxoethyl]-2-methyl-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | C721-0362 |
| Compound Name: | ethyl 1-[2-(2-fluoroanilino)-2-oxoethyl]-2-methyl-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 394.44 |
| Molecular Formula: | C23 H23 F N2 O3 |
| Smiles: | CCOC(c1cc(c2ccc(C)cc2)n(CC(Nc2ccccc2F)=O)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2754 |
| logD: | 5.2751 |
| logSw: | -5.1466 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.123 |
| InChI Key: | AYLPLBCAYGUENO-UHFFFAOYSA-N |