ethyl 2-methyl-1-{2-[(3-methylbutyl)amino]-2-oxoethyl}-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 2-methyl-1-{2-[(3-methylbutyl)amino]-2-oxoethyl}-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate
ethyl 2-methyl-1-{2-[(3-methylbutyl)amino]-2-oxoethyl}-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | C721-0408 |
| Compound Name: | ethyl 2-methyl-1-{2-[(3-methylbutyl)amino]-2-oxoethyl}-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 370.49 |
| Molecular Formula: | C22 H30 N2 O3 |
| Smiles: | CCOC(c1cc(c2ccc(C)cc2)n(CC(NCCC(C)C)=O)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9407 |
| logD: | 4.9407 |
| logSw: | -4.4405 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.256 |
| InChI Key: | BAJZNJGAVVIFCI-UHFFFAOYSA-N |