ethyl 1-[3-(2-methoxy-5-methylanilino)-3-oxopropyl]-2-methyl-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 1-[3-(2-methoxy-5-methylanilino)-3-oxopropyl]-2-methyl-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate
ethyl 1-[3-(2-methoxy-5-methylanilino)-3-oxopropyl]-2-methyl-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | C721-0777 |
| Compound Name: | ethyl 1-[3-(2-methoxy-5-methylanilino)-3-oxopropyl]-2-methyl-5-(4-methylphenyl)-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 434.53 |
| Molecular Formula: | C26 H30 N2 O4 |
| Smiles: | CCOC(c1cc(c2ccc(C)cc2)n(CCC(Nc2cc(C)ccc2OC)=O)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2378 |
| logD: | 5.2377 |
| logSw: | -4.9901 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.732 |
| InChI Key: | BLGYBFQGLPNJCI-UHFFFAOYSA-N |