ethyl 4-[(3-fluoro-4-methylphenyl)carbamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-[(3-fluoro-4-methylphenyl)carbamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate
ethyl 4-[(3-fluoro-4-methylphenyl)carbamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | C722-0192 |
| Compound Name: | ethyl 4-[(3-fluoro-4-methylphenyl)carbamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 318.35 |
| Molecular Formula: | C17 H19 F N2 O3 |
| Smiles: | [H]n1c(C)c(C(Nc2ccc(C)c(c2)F)=O)c(C)c1C(=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 3.7654 |
| logD: | 3.727 |
| logSw: | -4.1891 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.065 |
| InChI Key: | YBEZXFIFCRMXMT-UHFFFAOYSA-N |