ethyl 1,3,5-trimethyl-4-(4-methylpiperidine-1-carbonyl)-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 1,3,5-trimethyl-4-(4-methylpiperidine-1-carbonyl)-1H-pyrrole-2-carboxylate
ethyl 1,3,5-trimethyl-4-(4-methylpiperidine-1-carbonyl)-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | C722-0261 |
| Compound Name: | ethyl 1,3,5-trimethyl-4-(4-methylpiperidine-1-carbonyl)-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 306.4 |
| Molecular Formula: | C17 H26 N2 O3 |
| Smiles: | CCOC(c1c(C)c(C(N2CCC(C)CC2)=O)c(C)n1C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4122 |
| logD: | 2.4122 |
| logSw: | -2.0994 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.449 |
| InChI Key: | KXJWICMZKIAASP-UHFFFAOYSA-N |