N-[4-chloro-2-(trifluoromethyl)phenyl]-1-[(3-methylphenyl)methoxy]-2-oxo-1,2-dihydropyridine-3-carboxamide
Chemical Structure Depiction of
N-[4-chloro-2-(trifluoromethyl)phenyl]-1-[(3-methylphenyl)methoxy]-2-oxo-1,2-dihydropyridine-3-carboxamide
N-[4-chloro-2-(trifluoromethyl)phenyl]-1-[(3-methylphenyl)methoxy]-2-oxo-1,2-dihydropyridine-3-carboxamide
Compound characteristics
| Compound ID: | C723-0278 |
| Compound Name: | N-[4-chloro-2-(trifluoromethyl)phenyl]-1-[(3-methylphenyl)methoxy]-2-oxo-1,2-dihydropyridine-3-carboxamide |
| Molecular Weight: | 436.82 |
| Molecular Formula: | C21 H16 Cl F3 N2 O3 |
| Smiles: | Cc1cccc(CON2C=CC=C(C(Nc3ccc(cc3C(F)(F)F)[Cl])=O)C2=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.2352 |
| logD: | 4.5727 |
| logSw: | -5.4904 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.567 |
| InChI Key: | UVTJUTCPPZLAHM-UHFFFAOYSA-N |