7-acetyl-3-(4-methylphenyl)-1-[(3-methylphenyl)methyl]-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione
Chemical Structure Depiction of
7-acetyl-3-(4-methylphenyl)-1-[(3-methylphenyl)methyl]-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione
7-acetyl-3-(4-methylphenyl)-1-[(3-methylphenyl)methyl]-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | C728-0552 |
| Compound Name: | 7-acetyl-3-(4-methylphenyl)-1-[(3-methylphenyl)methyl]-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione |
| Molecular Weight: | 459.57 |
| Molecular Formula: | C26 H25 N3 O3 S |
| Smiles: | CC(N1CCc2c3C(N(C(N(Cc4cccc(C)c4)c3sc2C1)=O)c1ccc(C)cc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6115 |
| logD: | 4.6115 |
| logSw: | -4.5486 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.157 |
| InChI Key: | FLAMZKNRZGAFAL-UHFFFAOYSA-N |