N-(3-fluorophenyl)-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide
N-(3-fluorophenyl)-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide
Compound characteristics
| Compound ID: | C730-0366 |
| Compound Name: | N-(3-fluorophenyl)-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
| Molecular Weight: | 296.3 |
| Molecular Formula: | C17 H13 F N2 O2 |
| Smiles: | Cc1c(C(C(Nc2cccc(c2)F)=O)=O)c2ccccc2[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 3.5146 |
| logD: | 3.4268 |
| logSw: | -4.1667 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 46.994 |
| InChI Key: | RKXKTYWRLXLDPB-UHFFFAOYSA-N |