N-(3-chloro-2-methylphenyl)-3-phenyl-2-(1H-pyrrol-1-yl)propanamide
Chemical Structure Depiction of
N-(3-chloro-2-methylphenyl)-3-phenyl-2-(1H-pyrrol-1-yl)propanamide
N-(3-chloro-2-methylphenyl)-3-phenyl-2-(1H-pyrrol-1-yl)propanamide
Compound characteristics
| Compound ID: | C737-0465 |
| Compound Name: | N-(3-chloro-2-methylphenyl)-3-phenyl-2-(1H-pyrrol-1-yl)propanamide |
| Molecular Weight: | 338.84 |
| Molecular Formula: | C20 H19 Cl N2 O |
| Smiles: | Cc1c(cccc1[Cl])NC(C(Cc1ccccc1)n1cccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3082 |
| logD: | 5.3043 |
| logSw: | -5.7663 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.1545 |
| InChI Key: | USNXXGNWUDFRGW-IBGZPJMESA-N |