ethyl 4-({3,4-dioxo-2-[(1-phenylbutan-2-yl)amino]cyclobut-1-en-1-yl}amino)piperidine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-({3,4-dioxo-2-[(1-phenylbutan-2-yl)amino]cyclobut-1-en-1-yl}amino)piperidine-1-carboxylate
ethyl 4-({3,4-dioxo-2-[(1-phenylbutan-2-yl)amino]cyclobut-1-en-1-yl}amino)piperidine-1-carboxylate
Compound characteristics
| Compound ID: | C748-0215 |
| Compound Name: | ethyl 4-({3,4-dioxo-2-[(1-phenylbutan-2-yl)amino]cyclobut-1-en-1-yl}amino)piperidine-1-carboxylate |
| Molecular Weight: | 399.49 |
| Molecular Formula: | C22 H29 N3 O4 |
| Smiles: | CCC(Cc1ccccc1)NC1=C(C(C1=O)=O)NC1CCN(CC1)C(=O)OCC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4623 |
| logD: | 3.4611 |
| logSw: | -3.5178 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.336 |
| InChI Key: | OSGPYGOAYVYXMR-INIZCTEOSA-N |