1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine
Chemical Structure Depiction of
1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine
1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine
Compound characteristics
| Compound ID: | C749-0100 |
| Compound Name: | 1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine |
| Molecular Weight: | 259.31 |
| Molecular Formula: | C14 H17 N3 O2 |
| Smiles: | COc1ccc(cc1)c1nc(N2CCCCC2)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.4728 |
| logD: | 3.4728 |
| logSw: | -3.4476 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 42.983 |
| InChI Key: | WMRVZAJKDIJDHY-UHFFFAOYSA-N |