1-[(4-ethenylphenyl)methyl]-3-{[(2-phenylpropyl)amino]methyl}-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
1-[(4-ethenylphenyl)methyl]-3-{[(2-phenylpropyl)amino]methyl}-1H-indole-2-carboxylic acid
1-[(4-ethenylphenyl)methyl]-3-{[(2-phenylpropyl)amino]methyl}-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | C753-2746 |
| Compound Name: | 1-[(4-ethenylphenyl)methyl]-3-{[(2-phenylpropyl)amino]methyl}-1H-indole-2-carboxylic acid |
| Molecular Weight: | 424.54 |
| Molecular Formula: | C28 H28 N2 O2 |
| Smiles: | CC(CNCc1c2ccccc2n(Cc2ccc(C=C)cc2)c1C(O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9621 |
| logD: | 5.9621 |
| logSw: | -5.6477 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 40.642 |
| InChI Key: | LZAZNCODSRNOSP-FQEVSTJZSA-N |