N-{2-[4-(methylsulfanyl)phenyl]ethyl}-2-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetamide
Chemical Structure Depiction of
N-{2-[4-(methylsulfanyl)phenyl]ethyl}-2-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetamide
N-{2-[4-(methylsulfanyl)phenyl]ethyl}-2-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetamide
Compound characteristics
| Compound ID: | C759-0215 |
| Compound Name: | N-{2-[4-(methylsulfanyl)phenyl]ethyl}-2-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetamide |
| Molecular Weight: | 356.44 |
| Molecular Formula: | C19 H20 N2 O3 S |
| Smiles: | CSc1ccc(CCNC(CC2C(Nc3ccccc3O2)=O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5548 |
| logD: | 2.5548 |
| logSw: | -2.915 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.083 |
| InChI Key: | XZRKEHNEFRDYCA-KRWDZBQOSA-N |