N-(3-chloro-4-methylphenyl)-2-cyclohexyl-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)acetamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-2-cyclohexyl-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)acetamide
N-(3-chloro-4-methylphenyl)-2-cyclohexyl-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)acetamide
Compound characteristics
| Compound ID: | C761-0243 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-2-cyclohexyl-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)acetamide |
| Molecular Weight: | 381.92 |
| Molecular Formula: | C19 H24 Cl N O3 S |
| Smiles: | Cc1ccc(cc1[Cl])N(C1CS(C=C1)(=O)=O)C(CC1CCCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4296 |
| logD: | 4.4296 |
| logSw: | -4.4947 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.044 |
| InChI Key: | JTPRPKMTORTHMD-QGZVFWFLSA-N |