N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)-2,6-difluoro-N-phenylbenzamide
Chemical Structure Depiction of
N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)-2,6-difluoro-N-phenylbenzamide
N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)-2,6-difluoro-N-phenylbenzamide
Compound characteristics
| Compound ID: | C761-0652 |
| Compound Name: | N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)-2,6-difluoro-N-phenylbenzamide |
| Molecular Weight: | 349.35 |
| Molecular Formula: | C17 H13 F2 N O3 S |
| Smiles: | C1C(C=CS1(=O)=O)N(C(c1c(cccc1F)F)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1719 |
| logD: | 2.1719 |
| logSw: | -2.4321 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.379 |
| InChI Key: | VJELRYCGAKZWGV-ZDUSSCGKSA-N |