N-(3,5-dimethylphenyl)-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)pentanamide
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)pentanamide
N-(3,5-dimethylphenyl)-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)pentanamide
Compound characteristics
| Compound ID: | C761-1529 |
| Compound Name: | N-(3,5-dimethylphenyl)-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)pentanamide |
| Molecular Weight: | 321.44 |
| Molecular Formula: | C17 H23 N O3 S |
| Smiles: | CCCCC(N(C1CS(C=C1)(=O)=O)c1cc(C)cc(C)c1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2694 |
| logD: | 3.2694 |
| logSw: | -3.2832 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.124 |
| InChI Key: | SLDZOXQUWDINEB-HNNXBMFYSA-N |