4-(diethylsulfamoyl)-N-(3,5-dimethylphenyl)-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)benzamide
Chemical Structure Depiction of
4-(diethylsulfamoyl)-N-(3,5-dimethylphenyl)-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)benzamide
4-(diethylsulfamoyl)-N-(3,5-dimethylphenyl)-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)benzamide
Compound characteristics
| Compound ID: | C761-1600 |
| Compound Name: | 4-(diethylsulfamoyl)-N-(3,5-dimethylphenyl)-N-(1,1-dioxo-2,3-dihydro-1H-1lambda~6~-thiophen-3-yl)benzamide |
| Molecular Weight: | 476.61 |
| Molecular Formula: | C23 H28 N2 O5 S2 |
| Smiles: | CCN(CC)S(c1ccc(cc1)C(N(C1CS(C=C1)(=O)=O)c1cc(C)cc(C)c1)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1864 |
| logD: | 3.1864 |
| logSw: | -3.2864 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 74.476 |
| InChI Key: | PGIISPUGQRBVJX-FQEVSTJZSA-N |