(4-ethoxyphenyl)[6-fluoro-4-(morpholin-4-yl)quinolin-3-yl]methanone
Chemical Structure Depiction of
(4-ethoxyphenyl)[6-fluoro-4-(morpholin-4-yl)quinolin-3-yl]methanone
(4-ethoxyphenyl)[6-fluoro-4-(morpholin-4-yl)quinolin-3-yl]methanone
Compound characteristics
| Compound ID: | C768-0881 |
| Compound Name: | (4-ethoxyphenyl)[6-fluoro-4-(morpholin-4-yl)quinolin-3-yl]methanone |
| Molecular Weight: | 380.42 |
| Molecular Formula: | C22 H21 F N2 O3 |
| Smiles: | CCOc1ccc(cc1)C(c1cnc2ccc(cc2c1N1CCOCC1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9985 |
| logD: | 3.9985 |
| logSw: | -3.9796 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.441 |
| InChI Key: | VZVJQGFVJUXNDY-UHFFFAOYSA-N |