3-(4-chlorobenzene-1-sulfonyl)-N,N-diethyl-6-methoxyquinolin-4-amine
Chemical Structure Depiction of
3-(4-chlorobenzene-1-sulfonyl)-N,N-diethyl-6-methoxyquinolin-4-amine
3-(4-chlorobenzene-1-sulfonyl)-N,N-diethyl-6-methoxyquinolin-4-amine
Compound characteristics
| Compound ID: | C769-0721 |
| Compound Name: | 3-(4-chlorobenzene-1-sulfonyl)-N,N-diethyl-6-methoxyquinolin-4-amine |
| Molecular Weight: | 404.91 |
| Molecular Formula: | C20 H21 Cl N2 O3 S |
| Smiles: | CCN(CC)c1c(cnc2ccc(cc12)OC)S(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9448 |
| logD: | 4.9447 |
| logSw: | -4.9573 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.27 |
| InChI Key: | WUMZINWQNGDCPH-UHFFFAOYSA-N |