3-(4-chlorobenzene-1-sulfonyl)-6-fluoro-4-(3-methylpiperidin-1-yl)quinoline
Chemical Structure Depiction of
3-(4-chlorobenzene-1-sulfonyl)-6-fluoro-4-(3-methylpiperidin-1-yl)quinoline
3-(4-chlorobenzene-1-sulfonyl)-6-fluoro-4-(3-methylpiperidin-1-yl)quinoline
Compound characteristics
| Compound ID: | C769-0770 |
| Compound Name: | 3-(4-chlorobenzene-1-sulfonyl)-6-fluoro-4-(3-methylpiperidin-1-yl)quinoline |
| Molecular Weight: | 418.92 |
| Molecular Formula: | C21 H20 Cl F N2 O2 S |
| Smiles: | CC1CCCN(C1)c1c(cnc2ccc(cc12)F)S(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3214 |
| logD: | 5.3214 |
| logSw: | -5.9667 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.376 |
| InChI Key: | BWJHCPRODMDMQA-AWEZNQCLSA-N |