4-[4-(4-fluorophenyl)piperazin-1-yl]-6-methoxy-3-(4-methylbenzene-1-sulfonyl)quinoline
Chemical Structure Depiction of
4-[4-(4-fluorophenyl)piperazin-1-yl]-6-methoxy-3-(4-methylbenzene-1-sulfonyl)quinoline
4-[4-(4-fluorophenyl)piperazin-1-yl]-6-methoxy-3-(4-methylbenzene-1-sulfonyl)quinoline
Compound characteristics
| Compound ID: | C769-1143 |
| Compound Name: | 4-[4-(4-fluorophenyl)piperazin-1-yl]-6-methoxy-3-(4-methylbenzene-1-sulfonyl)quinoline |
| Molecular Weight: | 491.58 |
| Molecular Formula: | C27 H26 F N3 O3 S |
| Smiles: | Cc1ccc(cc1)S(c1cnc2ccc(cc2c1N1CCN(CC1)c1ccc(cc1)F)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6296 |
| logD: | 5.6295 |
| logSw: | -5.5283 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.246 |
| InChI Key: | VJPOGSNEZUHAQP-UHFFFAOYSA-N |