6-fluoro-3-(4-methoxybenzene-1-sulfonyl)-N-[(4-methylphenyl)methyl]quinolin-4-amine
Chemical Structure Depiction of
6-fluoro-3-(4-methoxybenzene-1-sulfonyl)-N-[(4-methylphenyl)methyl]quinolin-4-amine
6-fluoro-3-(4-methoxybenzene-1-sulfonyl)-N-[(4-methylphenyl)methyl]quinolin-4-amine
Compound characteristics
| Compound ID: | C769-1605 |
| Compound Name: | 6-fluoro-3-(4-methoxybenzene-1-sulfonyl)-N-[(4-methylphenyl)methyl]quinolin-4-amine |
| Molecular Weight: | 436.5 |
| Molecular Formula: | C24 H21 F N2 O3 S |
| Smiles: | Cc1ccc(CNc2c(cnc3ccc(cc23)F)S(c2ccc(cc2)OC)(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6627 |
| logD: | 4.6627 |
| logSw: | -4.2908 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.974 |
| InChI Key: | ILXTURKSCJFNIG-UHFFFAOYSA-N |