3-(benzenesulfonyl)-6-ethoxy-N-(4-ethoxyphenyl)quinolin-4-amine
Chemical Structure Depiction of
3-(benzenesulfonyl)-6-ethoxy-N-(4-ethoxyphenyl)quinolin-4-amine
3-(benzenesulfonyl)-6-ethoxy-N-(4-ethoxyphenyl)quinolin-4-amine
Compound characteristics
| Compound ID: | C769-1851 |
| Compound Name: | 3-(benzenesulfonyl)-6-ethoxy-N-(4-ethoxyphenyl)quinolin-4-amine |
| Molecular Weight: | 448.54 |
| Molecular Formula: | C25 H24 N2 O4 S |
| Smiles: | CCOc1ccc(cc1)Nc1c(cnc2ccc(cc12)OCC)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2881 |
| logD: | 5.2881 |
| logSw: | -5.3555 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.356 |
| InChI Key: | ITJJEUIKKOVQTD-UHFFFAOYSA-N |