3-(4-chlorobenzene-1-sulfonyl)-N-(3,4-dimethoxyphenyl)-6-methoxyquinolin-4-amine
Chemical Structure Depiction of
3-(4-chlorobenzene-1-sulfonyl)-N-(3,4-dimethoxyphenyl)-6-methoxyquinolin-4-amine
3-(4-chlorobenzene-1-sulfonyl)-N-(3,4-dimethoxyphenyl)-6-methoxyquinolin-4-amine
Compound characteristics
| Compound ID: | C769-2026 |
| Compound Name: | 3-(4-chlorobenzene-1-sulfonyl)-N-(3,4-dimethoxyphenyl)-6-methoxyquinolin-4-amine |
| Molecular Weight: | 484.96 |
| Molecular Formula: | C24 H21 Cl N2 O5 S |
| Smiles: | COc1ccc2c(c1)c(c(cn2)S(c1ccc(cc1)[Cl])(=O)=O)Nc1ccc(c(c1)OC)OC |
| Stereo: | ACHIRAL |
| logP: | 4.8464 |
| logD: | 4.8464 |
| logSw: | -4.921 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.913 |
| InChI Key: | LQUSDMVTCOXSKB-UHFFFAOYSA-N |