[6-methyl-4-(4-methylbenzene-1-sulfonyl)quinolin-3-yl](phenyl)methanone
Chemical Structure Depiction of
[6-methyl-4-(4-methylbenzene-1-sulfonyl)quinolin-3-yl](phenyl)methanone
[6-methyl-4-(4-methylbenzene-1-sulfonyl)quinolin-3-yl](phenyl)methanone
Compound characteristics
| Compound ID: | C770-0082 |
| Compound Name: | [6-methyl-4-(4-methylbenzene-1-sulfonyl)quinolin-3-yl](phenyl)methanone |
| Molecular Weight: | 401.48 |
| Molecular Formula: | C24 H19 N O3 S |
| Smiles: | Cc1ccc(cc1)S(c1c(cnc2ccc(C)cc12)C(c1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2737 |
| logD: | 5.2737 |
| logSw: | -5.1948 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.059 |
| InChI Key: | JLXCJWDAZPDPHA-UHFFFAOYSA-N |