(4-ethylphenyl)[9-(4-methylbenzene-1-sulfonyl)-2,3-dihydro[1,4]dioxino[2,3-g]quinolin-8-yl]methanone
Chemical Structure Depiction of
(4-ethylphenyl)[9-(4-methylbenzene-1-sulfonyl)-2,3-dihydro[1,4]dioxino[2,3-g]quinolin-8-yl]methanone
(4-ethylphenyl)[9-(4-methylbenzene-1-sulfonyl)-2,3-dihydro[1,4]dioxino[2,3-g]quinolin-8-yl]methanone
Compound characteristics
| Compound ID: | C770-0119 |
| Compound Name: | (4-ethylphenyl)[9-(4-methylbenzene-1-sulfonyl)-2,3-dihydro[1,4]dioxino[2,3-g]quinolin-8-yl]methanone |
| Molecular Weight: | 473.55 |
| Molecular Formula: | C27 H23 N O5 S |
| Smiles: | CCc1ccc(cc1)C(c1cnc2cc3c(cc2c1S(c1ccc(C)cc1)(=O)=O)OCCO3)=O |
| Stereo: | ACHIRAL |
| logP: | 4.555 |
| logD: | 4.555 |
| logSw: | -4.2019 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 67.882 |
| InChI Key: | LWEVGZZVNNRBGL-UHFFFAOYSA-N |