(4-ethoxyphenyl)[4-(4-methylbenzene-1-sulfonyl)quinolin-3-yl]methanone
Chemical Structure Depiction of
(4-ethoxyphenyl)[4-(4-methylbenzene-1-sulfonyl)quinolin-3-yl]methanone
(4-ethoxyphenyl)[4-(4-methylbenzene-1-sulfonyl)quinolin-3-yl]methanone
Compound characteristics
| Compound ID: | C770-0151 |
| Compound Name: | (4-ethoxyphenyl)[4-(4-methylbenzene-1-sulfonyl)quinolin-3-yl]methanone |
| Molecular Weight: | 431.51 |
| Molecular Formula: | C25 H21 N O4 S |
| Smiles: | CCOc1ccc(cc1)C(c1cnc2ccccc2c1S(c1ccc(C)cc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.178 |
| logD: | 5.178 |
| logSw: | -4.972 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 59.182 |
| InChI Key: | CSNLSEYSIMBWFA-UHFFFAOYSA-N |