1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide
Chemical Structure Depiction of
1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide
1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | C776-3620 |
| Compound Name: | 1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide |
| Molecular Weight: | 480.65 |
| Molecular Formula: | C31 H36 N4 O |
| Smiles: | CC(CCc1ccccc1)NC(C1CCN(CC1)c1nc2ccccc2n1Cc1ccc(C)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.481 |
| logD: | 6.465 |
| logSw: | -5.6374 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.015 |
| InChI Key: | RKRRQRCGCSNQLU-DEOSSOPVSA-N |