1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}-N-[(4-propoxyphenyl)methyl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}-N-[(4-propoxyphenyl)methyl]piperidine-4-carboxamide
1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}-N-[(4-propoxyphenyl)methyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | C776-3676 |
| Compound Name: | 1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}-N-[(4-propoxyphenyl)methyl]piperidine-4-carboxamide |
| Molecular Weight: | 496.65 |
| Molecular Formula: | C31 H36 N4 O2 |
| Smiles: | CCCOc1ccc(CNC(C2CCN(CC2)c2nc3ccccc3n2Cc2ccc(C)cc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.2606 |
| logD: | 6.2445 |
| logSw: | -5.4719 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.991 |
| InChI Key: | KGYKNZZLZUSLAT-UHFFFAOYSA-N |