methyl 6-[2-(3-fluoro-4-methylanilino)-2-oxoethyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
					Chemical Structure Depiction of
methyl 6-[2-(3-fluoro-4-methylanilino)-2-oxoethyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
			methyl 6-[2-(3-fluoro-4-methylanilino)-2-oxoethyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate
Compound characteristics
| Compound ID: | C777-0735 | 
| Compound Name: | methyl 6-[2-(3-fluoro-4-methylanilino)-2-oxoethyl]-6H-thieno[2,3-b]pyrrole-5-carboxylate | 
| Molecular Weight: | 346.38 | 
| Molecular Formula: | C17 H15 F N2 O3 S | 
| Smiles: | Cc1ccc(cc1F)NC(Cn1c(cc2ccsc12)C(=O)OC)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.9399 | 
| logD: | 3.9395 | 
| logSw: | -4.0283 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 45.869 | 
| InChI Key: | ONADBSYWPWMGPY-UHFFFAOYSA-N | 
 
				 
				