methyl 4-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylate
Chemical Structure Depiction of
methyl 4-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylate
methyl 4-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylate
Compound characteristics
| Compound ID: | C777-0828 |
| Compound Name: | methyl 4-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| Molecular Weight: | 337.8 |
| Molecular Formula: | C16 H13 Cl F N O2 S |
| Smiles: | Cc1cc2c(cc(C(=O)OC)n2Cc2c(cccc2[Cl])F)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.7722 |
| logD: | 4.7722 |
| logSw: | -4.8879 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 22.8847 |
| InChI Key: | BTNPXIHFVFGTJP-UHFFFAOYSA-N |