methyl 4-[2-(2,5-dimethylanilino)-2-oxoethyl]-2-ethyl-4H-thieno[3,2-b]pyrrole-5-carboxylate
Chemical Structure Depiction of
methyl 4-[2-(2,5-dimethylanilino)-2-oxoethyl]-2-ethyl-4H-thieno[3,2-b]pyrrole-5-carboxylate
methyl 4-[2-(2,5-dimethylanilino)-2-oxoethyl]-2-ethyl-4H-thieno[3,2-b]pyrrole-5-carboxylate
Compound characteristics
| Compound ID: | C777-1114 |
| Compound Name: | methyl 4-[2-(2,5-dimethylanilino)-2-oxoethyl]-2-ethyl-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| Molecular Weight: | 370.47 |
| Molecular Formula: | C20 H22 N2 O3 S |
| Smiles: | CCc1cc2c(cc(C(=O)OC)n2CC(Nc2cc(C)ccc2C)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.1083 |
| logD: | 4.1083 |
| logSw: | -4.1051 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.336 |
| InChI Key: | QUUGWFARTDQBQW-UHFFFAOYSA-N |