N-{3-[butyl(methyl)amino]propyl}-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperidine-4-carboxamide
Chemical Structure Depiction of
N-{3-[butyl(methyl)amino]propyl}-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperidine-4-carboxamide
N-{3-[butyl(methyl)amino]propyl}-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | C782-1306 |
| Compound Name: | N-{3-[butyl(methyl)amino]propyl}-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)piperidine-4-carboxamide |
| Molecular Weight: | 416.63 |
| Molecular Formula: | C23 H36 N4 O S |
| Smiles: | CCCCN(C)CCCNC(C1CCN(CC1)c1nc2c(C)cc(C)cc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6459 |
| logD: | 2.0488 |
| logSw: | -4.1533 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.596 |
| InChI Key: | VFDMKELLDNUZQA-UHFFFAOYSA-N |