N-cycloheptyl-2-(5-methyl-8-oxothieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-7(8H)-yl)propanamide
Chemical Structure Depiction of
N-cycloheptyl-2-(5-methyl-8-oxothieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-7(8H)-yl)propanamide
N-cycloheptyl-2-(5-methyl-8-oxothieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-7(8H)-yl)propanamide
Compound characteristics
| Compound ID: | C785-1192 |
| Compound Name: | N-cycloheptyl-2-(5-methyl-8-oxothieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-7(8H)-yl)propanamide |
| Molecular Weight: | 372.49 |
| Molecular Formula: | C19 H24 N4 O2 S |
| Smiles: | CC(C(NC1CCCCCC1)=O)N1C(c2cc3c(ccs3)n2C(C)=N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.629 |
| logD: | 3.629 |
| logSw: | -3.8574 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.669 |
| InChI Key: | RYQIJPHEFZKCJC-LBPRGKRZSA-N |